C27H39NO2 — CID 123324024
N-(2-cyclobutyloxyethyl)-7-(3-cyclohexylpropyl)-1-methyl-6,7-dihydronaphthalene-2-carboxamide (PubChem CID 123324024) has the molecular formula C27H39NO2 and a molecular weight of 409.61 g/mol. Its IUPAC name is N-(2-cyclobutyloxyethyl)-7-(3-cyclohexylpropyl)-1-methyl-6,7-dihydronaphthalene-2-carboxamide.
| Compound Name | N-(2-cyclobutyloxyethyl)-7-(3-cyclohexylpropyl)-1-methyl-6,7-dihydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 123324024 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | N-(2-cyclobutyloxyethyl)-7-(3-cyclohexylpropyl)-1-methyl-6,7-dihydronaphthalene-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCOC2CCC2)ccc2c1=CC(CCCC1CCCCC1)CC=2 |
| InChI | InChI=1S/C27H39NO2/c1-20-25(27(29)28-17-18-30-24-11-6-12-24)16-15-23-14-13-22(19-26(20)23)10-5-9-21-7-3-2-4-8-21/h14-16,19,21-22,24H,2-13,17-18H2,1H3,(H,28,29) |
| InChIKey | ISQLPAONBVYDRL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|