C29H43NO2 — CID 123404690
N-(2-cyclobutyloxyethyl)-6-(3-cyclohexylpropyl)-4,7-dimethyl-7,8-dihydro-6H-benzo[7]annulene-3-carboxamide (PubChem CID 123404690) has the molecular formula C29H43NO2 and a molecular weight of 437.67 g/mol. Its IUPAC name is N-(2-cyclobutyloxyethyl)-6-(3-cyclohexylpropyl)-4,7-dimethyl-7,8-dihydro-6H-benzo[7]annulene-3-carboxamide.
| Compound Name | N-(2-cyclobutyloxyethyl)-6-(3-cyclohexylpropyl)-4,7-dimethyl-7,8-dihydro-6H-benzo[7]annulene-3-carboxamide |
|---|---|
| PubChem CID | 123404690 |
| Molecular Formula | C29H43NO2 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.33 |
| IUPAC Name | N-(2-cyclobutyloxyethyl)-6-(3-cyclohexylpropyl)-4,7-dimethyl-7,8-dihydro-6H-benzo[7]annulene-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCOC2CCC2)ccc2c1=CC(CCCC1CCCCC1)C(C)CC=2 |
| InChI | InChI=1S/C29H43NO2/c1-21-14-15-24-16-17-27(29(31)30-18-19-32-26-12-7-13-26)22(2)28(24)20-25(21)11-6-10-23-8-4-3-5-9-23/h15-17,20-21,23,25-26H,3-14,18-19H2,1-2H3,(H,30,31) |
| InChIKey | VOFISHCRZATGHI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|