C32H48NO2+ — CID 123508541
(4aE,10E)-N-[2-(cyclopropylmethoxy)ethyl]-4-ethenyl-7-(4-ethyloctyl)-8-methyl-6,7,8,9-tetrahydrobenzo[8]annulene-3-carboxamide (PubChem CID 123508541) has the molecular formula C32H48NO2+ and a molecular weight of 478.74 g/mol. Its IUPAC name is (4aE,10E)-N-[2-(cyclopropylmethoxy)ethyl]-4-ethenyl-7-(4-ethyloctyl)-8-methyl-6,7,8,9-tetrahydrobenzo[8]annulene-3-carboxamide.
| Compound Name | (4aE,10E)-N-[2-(cyclopropylmethoxy)ethyl]-4-ethenyl-7-(4-ethyloctyl)-8-methyl-6,7,8,9-tetrahydrobenzo[8]annulene-3-carboxamide |
|---|---|
| PubChem CID | 123508541 |
| Molecular Formula | C32H48NO2+ |
| Molecular Weight | 478.74 g/mol |
| Exact Mass | 478.37 |
| IUPAC Name | (4aE,10E)-N-[2-(cyclopropylmethoxy)ethyl]-4-ethenyl-7-(4-ethyloctyl)-8-methyl-6,7,8,9-tetrahydrobenzo[8]annulene-3-carboxamide |
| SMILES | C=[C+]c1c(C(=O)NCCOCC2CC2)ccc2/c1=C\CC(CCCC(CC)CCCC)C(C)C/C=2 |
| InChI | InChI=1S/C32H47NO2/c1-5-8-10-25(6-2)11-9-12-27-17-19-30-28(16-13-24(27)4)18-20-31(29(30)7-3)32(34)33-21-22-35-23-26-14-15-26/h16,18-20,24-27H,3,5-6,8-15,17,21-23H2,1-2,4H3/p+1/b28-16-,30-19+ |
| InChIKey | CEQIPXXLCVQOCU-FAMFMDOYSA-O |
| XLogP | 6.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.74 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|