C25H36N2O2 — CID 123201210
2-(cycloheptylmethyl)-N-[2-(cyclopropylmethoxy)ethyl]-8-methyl-3H-isoquinoline-7-carboxamide (PubChem CID 123201210) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 2-(cycloheptylmethyl)-N-[2-(cyclopropylmethoxy)ethyl]-8-methyl-3H-isoquinoline-7-carboxamide.
| Compound Name | 2-(cycloheptylmethyl)-N-[2-(cyclopropylmethoxy)ethyl]-8-methyl-3H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 123201210 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 2-(cycloheptylmethyl)-N-[2-(cyclopropylmethoxy)ethyl]-8-methyl-3H-isoquinoline-7-carboxamide |
| SMILES | Cc1c(C(=O)NCCOCC2CC2)ccc2c1=CN(CC1CCCCCC1)CC=2 |
| InChI | InChI=1S/C25H36N2O2/c1-19-23(25(28)26-13-15-29-18-21-8-9-21)11-10-22-12-14-27(17-24(19)22)16-20-6-4-2-3-5-7-20/h10-12,17,20-21H,2-9,13-16,18H2,1H3,(H,26,28) |
| InChIKey | MFYKDEHVSMEWLI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|