C25H37N3O2 — CID 134188978
2-(cycloheptylmethyl)-6-methyl-N-(2-morpholin-4-ylethyl)-3H-isoquinoline-7-carboxamide (PubChem CID 134188978) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is 2-(cycloheptylmethyl)-6-methyl-N-(2-morpholin-4-ylethyl)-3H-isoquinoline-7-carboxamide.
| Compound Name | 2-(cycloheptylmethyl)-6-methyl-N-(2-morpholin-4-ylethyl)-3H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 134188978 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | 2-(cycloheptylmethyl)-6-methyl-N-(2-morpholin-4-ylethyl)-3H-isoquinoline-7-carboxamide |
| SMILES | Cc1cc2c(cc1C(=O)NCCN1CCOCC1)=CN(CC1CCCCCC1)CC=2 |
| InChI | InChI=1S/C25H37N3O2/c1-20-16-22-8-10-28(18-21-6-4-2-3-5-7-21)19-23(22)17-24(20)25(29)26-9-11-27-12-14-30-15-13-27/h8,16-17,19,21H,2-7,9-15,18H2,1H3,(H,26,29) |
| InChIKey | ZAVJURYASNGROV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |