C27H31ClN6O2 — CID 144749919
5-[4-amino-3-[amino(methyl)amino]-5-methylphenyl]-4-(4-chlorophenyl)-2-(3,6-dihydro-2H-pyran-4-yl)-3-propan-2-yl-4H-pyrrolo[3,4-d]imidazol-6-one (PubChem CID 144749919) has the molecular formula C27H31ClN6O2 and a molecular weight of 507.04 g/mol. Its IUPAC name is 5-[4-amino-3-[amino(methyl)amino]-5-methylphenyl]-4-(4-chlorophenyl)-2-(3,6-dihydro-2H-pyran-4-yl)-3-propan-2-yl-4H-pyrrolo[3,4-d]imidazol-6-one.
| Compound Name | 5-[4-amino-3-[amino(methyl)amino]-5-methylphenyl]-4-(4-chlorophenyl)-2-(3,6-dihydro-2H-pyran-4-yl)-3-propan-2-yl-4H-pyrrolo[3,4-d]imidazol-6-one |
|---|---|
| PubChem CID | 144749919 |
| Molecular Formula | C27H31ClN6O2 |
| Molecular Weight | 507.04 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 5-[4-amino-3-[amino(methyl)amino]-5-methylphenyl]-4-(4-chlorophenyl)-2-(3,6-dihydro-2H-pyran-4-yl)-3-propan-2-yl-4H-pyrrolo[3,4-d]imidazol-6-one |
| SMILES | Cc1cc(N2C(=O)c3nc(C4=CCOCC4)n(C(C)C)c3C2c2ccc(Cl)cc2)cc(N(C)N)c1N |
| InChI | InChI=1S/C27H31ClN6O2/c1-15(2)33-25-23(31-26(33)18-9-11-36-12-10-18)27(35)34(24(25)17-5-7-19(28)8-6-17)20-13-16(3)22(29)21(14-20)32(4)30/h5-9,13-15,24H,10-12,29-30H2,1-4H3 |
| InChIKey | GSIXAOHWZYIDQQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.04 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|