C26H25ClN6O2 — CID 86567782
(4R)-4-(4-chlorophenyl)-2-(2,5-dihydrofuran-3-yl)-5-(3,8-dimethyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-3-propan-2-yl-4H-pyrrolo[3,4-d]imidazol-6-one (PubChem CID 86567782) has the molecular formula C26H25ClN6O2 and a molecular weight of 488.98 g/mol. Its IUPAC name is (4R)-4-(4-chlorophenyl)-2-(2,5-dihydrofuran-3-yl)-5-(3,8-dimethyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-3-propan-2-yl-4H-pyrrolo[3,4-d]imidazol-6-one.
| Compound Name | (4R)-4-(4-chlorophenyl)-2-(2,5-dihydrofuran-3-yl)-5-(3,8-dimethyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-3-propan-2-yl-4H-pyrrolo[3,4-d]imidazol-6-one |
|---|---|
| PubChem CID | 86567782 |
| Molecular Formula | C26H25ClN6O2 |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | (4R)-4-(4-chlorophenyl)-2-(2,5-dihydrofuran-3-yl)-5-(3,8-dimethyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-3-propan-2-yl-4H-pyrrolo[3,4-d]imidazol-6-one |
| SMILES | Cc1cc(N2C(=O)c3nc(C4=CCOC4)n(C(C)C)c3[C@H]2c2ccc(Cl)cc2)cn2c(C)nnc12 |
| InChI | InChI=1S/C26H25ClN6O2/c1-14(2)32-23-21(28-25(32)18-9-10-35-13-18)26(34)33(22(23)17-5-7-19(27)8-6-17)20-11-15(3)24-30-29-16(4)31(24)12-20/h5-9,11-12,14,22H,10,13H2,1-4H3/t22-/m1/s1 |
| InChIKey | BUFWGONUWXTMGP-JOCHJYFZSA-N |
| XLogP | 4.94 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |