C25H21F3N4 — CID 144751734
6-[3-[(E)-2-[5-methyl-2-(trifluoromethyl)phenyl]ethenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 144751734) has the molecular formula C25H21F3N4 and a molecular weight of 434.47 g/mol. Its IUPAC name is 6-[3-[(E)-2-[5-methyl-2-(trifluoromethyl)phenyl]ethenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 6-[3-[(E)-2-[5-methyl-2-(trifluoromethyl)phenyl]ethenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 144751734 |
| Molecular Formula | C25H21F3N4 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 6-[3-[(E)-2-[5-methyl-2-(trifluoromethyl)phenyl]ethenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | Cc1ccc(C(F)(F)F)c(/C=C/c2c[nH]c3ncc(-c4cnc5c(c4)CCCN5)cc23)c1 |
| InChI | InChI=1S/C25H21F3N4/c1-15-4-7-22(25(26,27)28)16(9-15)5-6-18-12-31-24-21(18)11-20(14-32-24)19-10-17-3-2-8-29-23(17)30-13-19/h4-7,9-14H,2-3,8H2,1H3,(H,29,30)(H,31,32)/b6-5+ |
| InChIKey | CUERMKJSJCSWFO-AATRIKPKSA-N |
| XLogP | 6.48 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |