C7H12N2 — CID 144753233
(1Z)-N,N-dimethyl-1-(methylideneamino)buta-1,3-dien-1-amine (PubChem CID 144753233) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is (1Z)-N,N-dimethyl-1-(methylideneamino)buta-1,3-dien-1-amine.
| Compound Name | (1Z)-N,N-dimethyl-1-(methylideneamino)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144753233 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (1Z)-N,N-dimethyl-1-(methylideneamino)buta-1,3-dien-1-amine |
| SMILES | C=C/C=C(\N=C)N(C)C |
| InChI | InChI=1S/C7H12N2/c1-5-6-7(8-2)9(3)4/h5-6H,1-2H2,3-4H3/b7-6+ |
| InChIKey | YDDQKQMCTHNDRA-VOTSOKGWSA-N |
| XLogP | 1.28 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|