About N-[(1Z)-1-(azetidin-1-yl)buta-1,3-dienyl]methanimine
N-[(1Z)-1-(azetidin-1-yl)buta-1,3-dienyl]methanimine (PubChem CID 144753250) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is N-[(1Z)-1-(azetidin-1-yl)buta-1,3-dienyl]methanimine.
Molecular Properties
| Compound Name | N-[(1Z)-1-(azetidin-1-yl)buta-1,3-dienyl]methanimine |
| PubChem CID | 144753250 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | N-[(1Z)-1-(azetidin-1-yl)buta-1,3-dienyl]methanimine |
| SMILES | C=C/C=C(\N=C)N1CCC1 |
| InChI | InChI=1S/C8H12N2/c1-3-5-8(9-2)10-6-4-7-10/h3,5H,1-2,4,6-7H2/b8-5+ |
| InChIKey | DOUPKYXWHGNJEH-VMPITWQZSA-N |
| XLogP | 1.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-1-(azetidin-1-yl)buta-1,3-dienyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-1-(azetidin-1-yl)buta-1,3-dienyl]methanimine?
The IUPAC name of N-[(1Z)-1-(azetidin-1-yl)buta-1,3-dienyl]methanimine (CID 144753250) is N-[(1Z)-1-(azetidin-1-yl)buta-1,3-dienyl]methanimine.
What is the SMILES notation for N-[(1Z)-1-(azetidin-1-yl)buta-1,3-dienyl]methanimine?
The canonical SMILES for N-[(1Z)-1-(azetidin-1-yl)buta-1,3-dienyl]methanimine is C=C/C=C(\N=C)N1CCC1.
What is the InChIKey of N-[(1Z)-1-(azetidin-1-yl)buta-1,3-dienyl]methanimine?
The InChIKey is DOUPKYXWHGNJEH-VMPITWQZSA-N. The full InChI is InChI=1S/C8H12N2/c1-3-5-8(9-2)10-6-4-7-10/h3,5H,1-2,4,6-7H2/b8-5+.
What are the key properties of N-[(1Z)-1-(azetidin-1-yl)buta-1,3-dienyl]methanimine?
N-[(1Z)-1-(azetidin-1-yl)buta-1,3-dienyl]methanimine has a molecular weight of 136.20 g/mol, XLogP of 1.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-1-(azetidin-1-yl)buta-1,3-dienyl]methanimine is sourced from PubChem (CID 144753250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).