C9H14N2 — CID 162385871
N-[(1Z,3Z)-1-(azetidin-1-yl)penta-1,3-dienyl]methanimine (PubChem CID 162385871) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is N-[(1Z,3Z)-1-(azetidin-1-yl)penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3Z)-1-(azetidin-1-yl)penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 162385871 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | N-[(1Z,3Z)-1-(azetidin-1-yl)penta-1,3-dienyl]methanimine |
| SMILES | C=N/C(=C\C=C/C)N1CCC1 |
| InChI | InChI=1S/C9H14N2/c1-3-4-6-9(10-2)11-7-5-8-11/h3-4,6H,2,5,7-8H2,1H3/b4-3-,9-6+ |
| InChIKey | WEVQIXCXEGPLME-ZNUQQGBJSA-N |
| XLogP | 1.81 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|