C13H26N2 — CID 153372799
ethane;(1Z,3Z)-N-ethyl-1-(methylideneamino)-N-propylpenta-1,3-dien-1-amine (PubChem CID 153372799) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is ethane;(1Z,3Z)-N-ethyl-1-(methylideneamino)-N-propylpenta-1,3-dien-1-amine.
| Compound Name | ethane;(1Z,3Z)-N-ethyl-1-(methylideneamino)-N-propylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 153372799 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | ethane;(1Z,3Z)-N-ethyl-1-(methylideneamino)-N-propylpenta-1,3-dien-1-amine |
| SMILES | C=N/C(=C\C=C/C)N(CC)CCC.CC |
| InChI | InChI=1S/C11H20N2.C2H6/c1-5-8-9-11(12-4)13(7-3)10-6-2;1-2/h5,8-9H,4,6-7,10H2,1-3H3;1-2H3/b8-5-,11-9+; |
| InChIKey | FGGXTYKPGRTESN-UVRKQXKUSA-N |
| XLogP | 3.86 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|