C19H33BrN2O2 — CID 144754383
ethane;methyl 5-bromo-2-piperidin-1-ylbenzoate;N-methylpropan-1-amine (PubChem CID 144754383) has the molecular formula C19H33BrN2O2 and a molecular weight of 401.39 g/mol. Its IUPAC name is ethane;methyl 5-bromo-2-piperidin-1-ylbenzoate;N-methylpropan-1-amine.
| Compound Name | ethane;methyl 5-bromo-2-piperidin-1-ylbenzoate;N-methylpropan-1-amine |
|---|---|
| PubChem CID | 144754383 |
| Molecular Formula | C19H33BrN2O2 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | ethane;methyl 5-bromo-2-piperidin-1-ylbenzoate;N-methylpropan-1-amine |
| SMILES | CC.CCCNC.COC(=O)c1cc(Br)ccc1N1CCCCC1 |
| InChI | InChI=1S/C13H16BrNO2.C4H11N.C2H6/c1-17-13(16)11-9-10(14)5-6-12(11)15-7-3-2-4-8-15;1-3-4-5-2;1-2/h5-6,9H,2-4,7-8H2,1H3;5H,3-4H2,1-2H3;1-2H3 |
| InChIKey | NZBICNZMZOXYHD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |