C16H27NO3 — CID 144754819
tert-butyl (4aR,10aR)-7-methylidene-3,4a,5,6,8,9,10,10a-octahydro-2H-cycloocta[b][1,4]oxazine-4-carboxylate (PubChem CID 144754819) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is tert-butyl (4aR,10aR)-7-methylidene-3,4a,5,6,8,9,10,10a-octahydro-2H-cycloocta[b][1,4]oxazine-4-carboxylate.
| Compound Name | tert-butyl (4aR,10aR)-7-methylidene-3,4a,5,6,8,9,10,10a-octahydro-2H-cycloocta[b][1,4]oxazine-4-carboxylate |
|---|---|
| PubChem CID | 144754819 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | tert-butyl (4aR,10aR)-7-methylidene-3,4a,5,6,8,9,10,10a-octahydro-2H-cycloocta[b][1,4]oxazine-4-carboxylate |
| SMILES | C=C1CCC[C@H]2OCCN(C(=O)OC(C)(C)C)[C@@H]2CC1 |
| InChI | InChI=1S/C16H27NO3/c1-12-6-5-7-14-13(9-8-12)17(10-11-19-14)15(18)20-16(2,3)4/h13-14H,1,5-11H2,2-4H3/t13-,14-/m1/s1 |
| InChIKey | BDRDOXNBDXDMBP-ZIAGYGMSSA-N |
| XLogP | 3.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|