C14H23NS — CID 144755326
4,5-bis(ethenyl)-2-methylsulfanylpyridine;ethane (PubChem CID 144755326) has the molecular formula C14H23NS and a molecular weight of 237.41 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-2-methylsulfanylpyridine;ethane.
| Compound Name | 4,5-bis(ethenyl)-2-methylsulfanylpyridine;ethane |
|---|---|
| PubChem CID | 144755326 |
| Molecular Formula | C14H23NS |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 4,5-bis(ethenyl)-2-methylsulfanylpyridine;ethane |
| SMILES | C=Cc1cnc(SC)cc1C=C.CC.CC |
| InChI | InChI=1S/C10H11NS.2C2H6/c1-4-8-6-10(12-3)11-7-9(8)5-2;2*1-2/h4-7H,1-2H2,3H3;2*1-2H3 |
| InChIKey | BOTCUNPQIBOLFE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |