C7H7N3S — CID 156566273
5-methylsulfanyl-1H-pyrazolo[3,4-c]pyridine (PubChem CID 156566273) has the molecular formula C7H7N3S and a molecular weight of 165.22 g/mol. Its IUPAC name is 5-methylsulfanyl-1H-pyrazolo[3,4-c]pyridine.
| Compound Name | 5-methylsulfanyl-1H-pyrazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 156566273 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 5-methylsulfanyl-1H-pyrazolo[3,4-c]pyridine |
| SMILES | CSc1cc2cn[nH]c2cn1 |
| InChI | InChI=1S/C7H7N3S/c1-11-7-2-5-3-9-10-6(5)4-8-7/h2-4H,1H3,(H,9,10) |
| InChIKey | JIZUCCSDCUAGQI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |