C30H42O13 — CID 144756145
4-(2-hydroxyethyl)benzene-1,2-diol;[(2R,3S,5R)-5-hydroxy-2-(hydroxymethyl)oxan-3-yl] (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate;(2R,5R,6S)-6-methyloxane-2,5-diol (PubChem CID 144756145) has the molecular formula C30H42O13 and a molecular weight of 610.65 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)benzene-1,2-diol;[(2R,3S,5R)-5-hydroxy-2-(hydroxymethyl)oxan-3-yl] (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate;(2R,5R,6S)-6-methyloxane-2,5-diol.
| Compound Name | 4-(2-hydroxyethyl)benzene-1,2-diol;[(2R,3S,5R)-5-hydroxy-2-(hydroxymethyl)oxan-3-yl] (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate;(2R,5R,6S)-6-methyloxane-2,5-diol |
|---|---|
| PubChem CID | 144756145 |
| Molecular Formula | C30H42O13 |
| Molecular Weight | 610.65 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | 4-(2-hydroxyethyl)benzene-1,2-diol;[(2R,3S,5R)-5-hydroxy-2-(hydroxymethyl)oxan-3-yl] (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate;(2R,5R,6S)-6-methyloxane-2,5-diol |
| SMILES | COc1ccc(/C=C/C(=O)O[C@H]2C[C@@H](O)CO[C@@H]2CO)cc1O.C[C@@H]1O[C@@H](O)CC[C@H]1O.OCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H20O7.C8H10O3.C6H12O3/c1-21-13-4-2-10(6-12(13)19)3-5-16(20)23-14-7-11(18)9-22-15(14)8-17;9-4-3-6-1-2-7(10)8(11)5-6;1-4-5(7)2-3-6(8)9-4/h2-6,11,14-15,17-19H,7-9H2,1H3;1-2,5,9-11H,3-4H2;4-8H,2-3H2,1H3/b5-3+;;/t11-,14+,15-;;4-,5+,6+/m1.0/s1 |
| InChIKey | PMPZNPSDDAEJIB-PCJOMNGESA-N |
| XLogP | 0.97 |
| TPSA | 215.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.65 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|