C16H11N5OS — CID 144756270
2-(3,6-diamino-2-cyano-4-methoxyphenyl)thieno[2,3-b]pyridine-5-carbonitrile (PubChem CID 144756270) has the molecular formula C16H11N5OS and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-(3,6-diamino-2-cyano-4-methoxyphenyl)thieno[2,3-b]pyridine-5-carbonitrile.
| Compound Name | 2-(3,6-diamino-2-cyano-4-methoxyphenyl)thieno[2,3-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 144756270 |
| Molecular Formula | C16H11N5OS |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-(3,6-diamino-2-cyano-4-methoxyphenyl)thieno[2,3-b]pyridine-5-carbonitrile |
| SMILES | COc1cc(N)c(-c2cc3cc(C#N)cnc3s2)c(C#N)c1N |
| InChI | InChI=1S/C16H11N5OS/c1-22-12-4-11(19)14(10(6-18)15(12)20)13-3-9-2-8(5-17)7-21-16(9)23-13/h2-4,7H,19-20H2,1H3 |
| InChIKey | HGRDBFRRJORDFF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 121.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|