C60H39B5N2O5 — CID 144756290
CID 144756290 (PubChem CID 144756290) has the molecular formula C60H39B5N2O5 and a molecular weight of 922.04 g/mol.
| Compound Name | CID 144756290 |
|---|---|
| PubChem CID | 144756290 |
| Molecular Formula | C60H39B5N2O5 |
| Molecular Weight | 922.04 g/mol |
| Exact Mass | 922.33 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3cccc(-c4cccc(-c5ccc(N(c6ccc(-c7ccccc7)cc6)c6c(O)c([B])c(O)c(O)c6O)cc5)c4)c3)cc2)c(O)c1[B] |
| InChI | InChI=1S/C60H39B5N2O5/c61-49-50(62)52(64)56(68)54(51(49)63)66(45-25-17-37(18-26-45)35-9-3-1-4-10-35)46-29-21-39(22-30-46)41-13-7-15-43(33-41)44-16-8-14-42(34-44)40-23-31-48(32-24-40)67(55-57(69)53(65)58(70)60(72)59(55)71)47-27-19-38(20-28-47)36-11-5-2-6-12-36/h1-34,68-72H |
| InChIKey | TWLWYHSQPVBCLP-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.04 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|