About CID 144756290
CID 144756290 (PubChem CID 144756290) has the molecular formula C60H39B5N2O5
and a molecular weight of 922.04 g/mol.
Molecular Properties
| Compound Name | CID 144756290 |
| PubChem CID | 144756290 |
| Molecular Formula | C60H39B5N2O5 |
| Molecular Weight | 922.04 g/mol |
| Exact Mass | 922.33 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3cccc(-c4cccc(-c5ccc(N(c6ccc(-c7ccccc7)cc6)c6c(O)c([B])c(O)c(O)c6O)cc5)c4)c3)cc2)c(O)c1[B] |
| InChI | InChI=1S/C60H39B5N2O5/c61-49-50(62)52(64)56(68)54(51(49)63)66(45-25-17-37(18-26-45)35-9-3-1-4-10-35)46-29-21-39(22-30-46)41-13-7-15-43(33-41)44-16-8-14-42(34-44)40-23-31-48(32-24-40)67(55-57(69)53(65)58(70)60(72)59(55)71)47-27-19-38(20-28-47)36-11-5-2-6-12-36/h1-34,68-72H |
| InChIKey | TWLWYHSQPVBCLP-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 72 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 922.04 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze CID 144756290 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144756290?
The IUPAC name of CID 144756290 (CID 144756290) is not available.
What is the SMILES notation for CID 144756290?
The canonical SMILES for CID 144756290 is [B]c1c([B])c([B])c(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3cccc(-c4cccc(-c5ccc(N(c6ccc(-c7ccccc7)cc6)c6c(O)c([B])c(O)c(O)c6O)cc5)c4)c3)cc2)c(O)c1[B].
What is the InChIKey of CID 144756290?
The InChIKey is TWLWYHSQPVBCLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C60H39B5N2O5/c61-49-50(62)52(64)56(68)54(51(49)63)66(45-25-17-37(18-26-45)35-9-3-1-4-10-35)46-29-21-39(22-30-46)41-13-7-15-43(33-41)44-16-8-14-42(34-44)40-23-31-48(32-24-40)67(55-57(69)53(65)58(70)60(72)59(55)71)47-27-19-38(20-28-47)36-11-5-2-6-12-36/h1-34,68-72H.
What are the key properties of CID 144756290?
CID 144756290 has a molecular weight of 922.04 g/mol, XLogP of 9.46, 11 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144756290 is sourced from PubChem (CID 144756290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).