C17H14O3S3 — CID 144756543
2-(3-methyl-2-sulfanyloxyphenyl)-1,4-bis(sulfanyloxy)naphthalene (PubChem CID 144756543) has the molecular formula C17H14O3S3 and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-(3-methyl-2-sulfanyloxyphenyl)-1,4-bis(sulfanyloxy)naphthalene.
| Compound Name | 2-(3-methyl-2-sulfanyloxyphenyl)-1,4-bis(sulfanyloxy)naphthalene |
|---|---|
| PubChem CID | 144756543 |
| Molecular Formula | C17H14O3S3 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2-(3-methyl-2-sulfanyloxyphenyl)-1,4-bis(sulfanyloxy)naphthalene |
| SMILES | Cc1cccc(-c2cc(OS)c3ccccc3c2OS)c1OS |
| InChI | InChI=1S/C17H14O3S3/c1-10-5-4-8-13(16(10)19-22)14-9-15(18-21)11-6-2-3-7-12(11)17(14)20-23/h2-9,21-23H,1H3 |
| InChIKey | PQWZURLYGBMOCK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|