C26H36F2N2O2 — CID 144756920
(E)-2-ethenylimino-N-[(3-ethoxyphenyl)-(1-methylcyclohexyl)methyl]-5,5-difluoro-3,4-dimethylhex-3-enamide (PubChem CID 144756920) has the molecular formula C26H36F2N2O2 and a molecular weight of 446.58 g/mol. Its IUPAC name is (E)-2-ethenylimino-N-[(3-ethoxyphenyl)-(1-methylcyclohexyl)methyl]-5,5-difluoro-3,4-dimethylhex-3-enamide.
| Compound Name | (E)-2-ethenylimino-N-[(3-ethoxyphenyl)-(1-methylcyclohexyl)methyl]-5,5-difluoro-3,4-dimethylhex-3-enamide |
|---|---|
| PubChem CID | 144756920 |
| Molecular Formula | C26H36F2N2O2 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (E)-2-ethenylimino-N-[(3-ethoxyphenyl)-(1-methylcyclohexyl)methyl]-5,5-difluoro-3,4-dimethylhex-3-enamide |
| SMILES | C=C/N=C(C(=O)NC(c1cccc(OCC)c1)C1(C)CCCCC1)\C(C)=C(/C)C(C)(F)F |
| InChI | InChI=1S/C26H36F2N2O2/c1-7-29-22(18(3)19(4)26(6,27)28)24(31)30-23(25(5)15-10-9-11-16-25)20-13-12-14-21(17-20)32-8-2/h7,12-14,17,23H,1,8-11,15-16H2,2-6H3,(H,30,31)/b19-18+,29-22+ |
| InChIKey | QLGLUCNNYURWDM-NMEBLIJDSA-N |
| XLogP | 6.79 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|