C20H25F2NO — CID 144756926
4,4-difluoro-1-[1-[3-[(Z)-1-methyliminobut-2-en-2-yl]phenyl]ethyl]cyclohexane-1-carbaldehyde (PubChem CID 144756926) has the molecular formula C20H25F2NO and a molecular weight of 333.42 g/mol. Its IUPAC name is 4,4-difluoro-1-[1-[3-[(Z)-1-methyliminobut-2-en-2-yl]phenyl]ethyl]cyclohexane-1-carbaldehyde.
| Compound Name | 4,4-difluoro-1-[1-[3-[(Z)-1-methyliminobut-2-en-2-yl]phenyl]ethyl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 144756926 |
| Molecular Formula | C20H25F2NO |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 4,4-difluoro-1-[1-[3-[(Z)-1-methyliminobut-2-en-2-yl]phenyl]ethyl]cyclohexane-1-carbaldehyde |
| SMILES | C/C=C(\C=N\C)c1cccc(C(C)C2(C=O)CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C20H25F2NO/c1-4-16(13-23-3)18-7-5-6-17(12-18)15(2)19(14-24)8-10-20(21,22)11-9-19/h4-7,12-15H,8-11H2,1-3H3/b16-4+,23-13+ |
| InChIKey | YSLWKWKNYSTZFC-QTMBYKJHSA-N |
| XLogP | 5.29 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|