C17H23N3O — CID 144757764
5-butyl-2-phenylmethoxy-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine (PubChem CID 144757764) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 5-butyl-2-phenylmethoxy-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine.
| Compound Name | 5-butyl-2-phenylmethoxy-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 144757764 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 5-butyl-2-phenylmethoxy-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
| SMILES | CCCCN1CCn2nc(OCc3ccccc3)cc2C1 |
| InChI | InChI=1S/C17H23N3O/c1-2-3-9-19-10-11-20-16(13-19)12-17(18-20)21-14-15-7-5-4-6-8-15/h4-8,12H,2-3,9-11,13-14H2,1H3 |
| InChIKey | MKNHDWYSMLGCJJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |