C14H17N3 — CID 137452745
5-benzyl-2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine (PubChem CID 137452745) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 5-benzyl-2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine.
| Compound Name | 5-benzyl-2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 137452745 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 5-benzyl-2-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
| SMILES | Cc1cc2n(n1)CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C14H17N3/c1-12-9-14-11-16(7-8-17(14)15-12)10-13-5-3-2-4-6-13/h2-6,9H,7-8,10-11H2,1H3 |
| InChIKey | BXHXUHPLAZUMNP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |