C13H15N3 — CID 67958777
5-benzyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine (PubChem CID 67958777) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 5-benzyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine.
| Compound Name | 5-benzyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 67958777 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 5-benzyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
| SMILES | c1ccc(CN2CCn3nccc3C2)cc1 |
| InChI | InChI=1S/C13H15N3/c1-2-4-12(5-3-1)10-15-8-9-16-13(11-15)6-7-14-16/h1-7H,8-11H2 |
| InChIKey | PUYBUZILSAMZQT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |