About 5-benzyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine
5-benzyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine (PubChem CID 162422052) has the molecular formula C14H17N3
and a molecular weight of 227.31 g/mol. Its IUPAC name is 5-benzyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 5-benzyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
| PubChem CID | 162422052 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 5-benzyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
| SMILES | CC1Cn2nccc2CN1Cc1ccccc1 |
| InChI | InChI=1S/C14H17N3/c1-12-9-17-14(7-8-15-17)11-16(12)10-13-5-3-2-4-6-13/h2-8,12H,9-11H2,1H3 |
| InChIKey | SUVJFGQTOGCPBB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-benzyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine?
The IUPAC name of 5-benzyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine (CID 162422052) is 5-benzyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine.
What is the SMILES notation for 5-benzyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine?
The canonical SMILES for 5-benzyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine is CC1Cn2nccc2CN1Cc1ccccc1.
What is the InChIKey of 5-benzyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine?
The InChIKey is SUVJFGQTOGCPBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3/c1-12-9-17-14(7-8-15-17)11-16(12)10-13-5-3-2-4-6-13/h2-8,12H,9-11H2,1H3.
What are the key properties of 5-benzyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine?
5-benzyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine has a molecular weight of 227.31 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine is sourced from PubChem (CID 162422052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).