C19H18BrN3 — CID 171367238
5-benzyl-2-(4-bromophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine (PubChem CID 171367238) has the molecular formula C19H18BrN3 and a molecular weight of 368.28 g/mol. Its IUPAC name is 5-benzyl-2-(4-bromophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine.
| Compound Name | 5-benzyl-2-(4-bromophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 171367238 |
| Molecular Formula | C19H18BrN3 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 5-benzyl-2-(4-bromophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
| SMILES | Brc1ccc(-c2cc3n(n2)CCN(Cc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C19H18BrN3/c20-17-8-6-16(7-9-17)19-12-18-14-22(10-11-23(18)21-19)13-15-4-2-1-3-5-15/h1-9,12H,10-11,13-14H2 |
| InChIKey | CZMJBJKOTLHQKU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |