C17H25N3O3 — CID 144757819
1-[2-[(E)-2-ethenylpent-2-enoxy]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]-2-ethoxyethanone (PubChem CID 144757819) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-[2-[(E)-2-ethenylpent-2-enoxy]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]-2-ethoxyethanone.
| Compound Name | 1-[2-[(E)-2-ethenylpent-2-enoxy]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]-2-ethoxyethanone |
|---|---|
| PubChem CID | 144757819 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-[2-[(E)-2-ethenylpent-2-enoxy]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]-2-ethoxyethanone |
| SMILES | C=C/C(=C\CC)COc1cc2n(n1)CCN(C(=O)COCC)C2 |
| InChI | InChI=1S/C17H25N3O3/c1-4-7-14(5-2)12-23-16-10-15-11-19(8-9-20(15)18-16)17(21)13-22-6-3/h5,7,10H,2,4,6,8-9,11-13H2,1,3H3/b14-7+ |
| InChIKey | LANSXUZJIOWDKY-VGOFMYFVSA-N |
| XLogP | 2.16 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|