C30H52O4 — CID 144759751
6-(14-hydroxy-6-methoxy-2,7,7,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)-2-methylhexane-2,3-diol (PubChem CID 144759751) has the molecular formula C30H52O4 and a molecular weight of 476.74 g/mol. Its IUPAC name is 6-(14-hydroxy-6-methoxy-2,7,7,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)-2-methylhexane-2,3-diol.
| Compound Name | 6-(14-hydroxy-6-methoxy-2,7,7,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)-2-methylhexane-2,3-diol |
|---|---|
| PubChem CID | 144759751 |
| Molecular Formula | C30H52O4 |
| Molecular Weight | 476.74 g/mol |
| Exact Mass | 476.39 |
| IUPAC Name | 6-(14-hydroxy-6-methoxy-2,7,7,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)-2-methylhexane-2,3-diol |
| SMILES | COC1CCC23C(CCC4C5CC(O)C(CCCC(O)C(C)(C)O)C5(C)CCC42C3C)C1(C)C |
| InChI | InChI=1S/C30H52O4/c1-18-29-16-15-28(6)20(9-8-10-24(32)27(4,5)33)22(31)17-21(28)19(29)11-12-23-26(2,3)25(34-7)13-14-30(18,23)29/h18-25,31-33H,8-17H2,1-7H3 |
| InChIKey | CXDMLEDPFNVBCW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.74 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |