C15H17N5O2S — CID 144760912
methyl N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)amino]-2-oxoethyl]-2,3-dihydro-1-benzofuran-5-carboximidothioate (PubChem CID 144760912) has the molecular formula C15H17N5O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is methyl N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)amino]-2-oxoethyl]-2,3-dihydro-1-benzofuran-5-carboximidothioate.
| Compound Name | methyl N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)amino]-2-oxoethyl]-2,3-dihydro-1-benzofuran-5-carboximidothioate |
|---|---|
| PubChem CID | 144760912 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | methyl N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)amino]-2-oxoethyl]-2,3-dihydro-1-benzofuran-5-carboximidothioate |
| SMILES | CS/C(=N\CC(=O)Nc1n[nH]c(C)n1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C15H17N5O2S/c1-9-17-15(20-19-9)18-13(21)8-16-14(23-2)11-3-4-12-10(7-11)5-6-22-12/h3-4,7H,5-6,8H2,1-2H3,(H2,17,18,19,20,21)/b16-14- |
| InChIKey | ULZMVILXGBXGIW-PEZBUJJGSA-N |
| XLogP | 1.80 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|