C27H31N3 — CID 144761416
3,5-dimethyl-4-[2-[2-(1,2,3-trimethylcyclobutyl)phenyl]imidazol-1-yl]benzonitrile;ethene (PubChem CID 144761416) has the molecular formula C27H31N3 and a molecular weight of 397.57 g/mol. Its IUPAC name is 3,5-dimethyl-4-[2-[2-(1,2,3-trimethylcyclobutyl)phenyl]imidazol-1-yl]benzonitrile;ethene.
| Compound Name | 3,5-dimethyl-4-[2-[2-(1,2,3-trimethylcyclobutyl)phenyl]imidazol-1-yl]benzonitrile;ethene |
|---|---|
| PubChem CID | 144761416 |
| Molecular Formula | C27H31N3 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 3,5-dimethyl-4-[2-[2-(1,2,3-trimethylcyclobutyl)phenyl]imidazol-1-yl]benzonitrile;ethene |
| SMILES | C=C.Cc1cc(C#N)cc(C)c1-n1ccnc1-c1ccccc1C1(C)CC(C)C1C |
| InChI | InChI=1S/C25H27N3.C2H4/c1-16-12-20(15-26)13-17(2)23(16)28-11-10-27-24(28)21-8-6-7-9-22(21)25(5)14-18(3)19(25)4;1-2/h6-13,18-19H,14H2,1-5H3;1-2H2 |
| InChIKey | YOFZWIQWIXLBJL-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|