C18H16N2 — CID 91516948
5-methyl-5-(4-methylphenyl)imidazo[2,1-a]isoindole (PubChem CID 91516948) has the molecular formula C18H16N2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 5-methyl-5-(4-methylphenyl)imidazo[2,1-a]isoindole.
| Compound Name | 5-methyl-5-(4-methylphenyl)imidazo[2,1-a]isoindole |
|---|---|
| PubChem CID | 91516948 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5-methyl-5-(4-methylphenyl)imidazo[2,1-a]isoindole |
| SMILES | Cc1ccc(C2(C)c3ccccc3-c3nccn32)cc1 |
| InChI | InChI=1S/C18H16N2/c1-13-7-9-14(10-8-13)18(2)16-6-4-3-5-15(16)17-19-11-12-20(17)18/h3-12H,1-2H3 |
| InChIKey | VWQFWIBNLSOBJX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |