C10H25N3 — CID 144761488
1-N"-tert-butyl-1-N"-ethyl-1-N',1-N'-dimethylethane-1,1,1-triamine (PubChem CID 144761488) has the molecular formula C10H25N3 and a molecular weight of 187.33 g/mol. Its IUPAC name is 1-N"-tert-butyl-1-N"-ethyl-1-N',1-N'-dimethylethane-1,1,1-triamine.
| Compound Name | 1-N"-tert-butyl-1-N"-ethyl-1-N',1-N'-dimethylethane-1,1,1-triamine |
|---|---|
| PubChem CID | 144761488 |
| Molecular Formula | C10H25N3 |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.20 |
| IUPAC Name | 1-N"-tert-butyl-1-N"-ethyl-1-N',1-N'-dimethylethane-1,1,1-triamine |
| SMILES | CCN(C(C)(C)C)C(C)(N)N(C)C |
| InChI | InChI=1S/C10H25N3/c1-8-13(9(2,3)4)10(5,11)12(6)7/h8,11H2,1-7H3 |
| InChIKey | VBMWUQKIDZJDQQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|