C20H50N6W — CID 87511911
bis(N,N-bis[ethyl(methyl)amino]-2-methylpropan-2-amine);tungsten (PubChem CID 87511911) has the molecular formula C20H50N6W and a molecular weight of 558.50 g/mol. Its IUPAC name is bis(N,N-bis[ethyl(methyl)amino]-2-methylpropan-2-amine);tungsten.
| Compound Name | bis(N,N-bis[ethyl(methyl)amino]-2-methylpropan-2-amine);tungsten |
|---|---|
| PubChem CID | 87511911 |
| Molecular Formula | C20H50N6W |
| Molecular Weight | 558.50 g/mol |
| Exact Mass | 558.36 |
| IUPAC Name | bis(N,N-bis[ethyl(methyl)amino]-2-methylpropan-2-amine);tungsten |
| SMILES | CCN(C)N(N(C)CC)C(C)(C)C.CCN(C)N(N(C)CC)C(C)(C)C.[W] |
| InChI | InChI=1S/2C10H25N3.W/c2*1-8-11(6)13(10(3,4)5)12(7)9-2;/h2*8-9H2,1-7H3; |
| InChIKey | GNAAVEHIQZGPIT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|