About N,N-diethyl-2-methylpropan-2-amine;dimethylsilane
N,N-diethyl-2-methylpropan-2-amine;dimethylsilane (PubChem CID 173297747) has the molecular formula C10H27NSi
and a molecular weight of 189.42 g/mol. Its IUPAC name is N,N-diethyl-2-methylpropan-2-amine;dimethylsilane.
Molecular Properties
| Compound Name | N,N-diethyl-2-methylpropan-2-amine;dimethylsilane |
| PubChem CID | 173297747 |
| Molecular Formula | C10H27NSi |
| Molecular Weight | 189.42 g/mol |
| Exact Mass | 189.19 |
| IUPAC Name | N,N-diethyl-2-methylpropan-2-amine;dimethylsilane |
| SMILES | CCN(CC)C(C)(C)C.C[SiH2]C |
| InChI | InChI=1S/C8H19N.C2H8Si/c1-6-9(7-2)8(3,4)5;1-3-2/h6-7H2,1-5H3;3H2,1-2H3 |
| InChIKey | GNSJCQCWGWYJFE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-2-methylpropan-2-amine;dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-methylpropan-2-amine;dimethylsilane?
The IUPAC name of N,N-diethyl-2-methylpropan-2-amine;dimethylsilane (CID 173297747) is N,N-diethyl-2-methylpropan-2-amine;dimethylsilane.
What is the SMILES notation for N,N-diethyl-2-methylpropan-2-amine;dimethylsilane?
The canonical SMILES for N,N-diethyl-2-methylpropan-2-amine;dimethylsilane is CCN(CC)C(C)(C)C.C[SiH2]C.
What is the InChIKey of N,N-diethyl-2-methylpropan-2-amine;dimethylsilane?
The InChIKey is GNSJCQCWGWYJFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C2H8Si/c1-6-9(7-2)8(3,4)5;1-3-2/h6-7H2,1-5H3;3H2,1-2H3.
What are the key properties of N,N-diethyl-2-methylpropan-2-amine;dimethylsilane?
N,N-diethyl-2-methylpropan-2-amine;dimethylsilane has a molecular weight of 189.42 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-methylpropan-2-amine;dimethylsilane is sourced from PubChem (CID 173297747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).