C9H17F2NO2 — CID 165466732
3-[tert-butyl(ethyl)amino]-2,2-difluoropropanoic acid (PubChem CID 165466732) has the molecular formula C9H17F2NO2 and a molecular weight of 209.24 g/mol. Its IUPAC name is 3-[tert-butyl(ethyl)amino]-2,2-difluoropropanoic acid.
| Compound Name | 3-[tert-butyl(ethyl)amino]-2,2-difluoropropanoic acid |
|---|---|
| PubChem CID | 165466732 |
| Molecular Formula | C9H17F2NO2 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3-[tert-butyl(ethyl)amino]-2,2-difluoropropanoic acid |
| SMILES | CCN(CC(F)(F)C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C9H17F2NO2/c1-5-12(8(2,3)4)6-9(10,11)7(13)14/h5-6H2,1-4H3,(H,13,14) |
| InChIKey | HPUWIKWGTCKWAN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |