C15H35N3 — CID 174059881
1-N,1-N,1-N',1-N',1-N",1-N"-hexaethylpropane-1,1,1-triamine (PubChem CID 174059881) has the molecular formula C15H35N3 and a molecular weight of 257.47 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',1-N",1-N"-hexaethylpropane-1,1,1-triamine.
| Compound Name | 1-N,1-N,1-N',1-N',1-N",1-N"-hexaethylpropane-1,1,1-triamine |
|---|---|
| PubChem CID | 174059881 |
| Molecular Formula | C15H35N3 |
| Molecular Weight | 257.47 g/mol |
| Exact Mass | 257.28 |
| IUPAC Name | 1-N,1-N,1-N',1-N',1-N",1-N"-hexaethylpropane-1,1,1-triamine |
| SMILES | CCN(CC)C(CC)(N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C15H35N3/c1-8-15(16(9-2)10-3,17(11-4)12-5)18(13-6)14-7/h8-14H2,1-7H3 |
| InChIKey | AGJYKMINNPOUJH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|