C18H41N3O3 — CID 175722922
2-(hydroxymethyl)-2-[2,2,2-tris(diethylamino)ethyl]propane-1,3-diol (PubChem CID 175722922) has the molecular formula C18H41N3O3 and a molecular weight of 347.54 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-[2,2,2-tris(diethylamino)ethyl]propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-[2,2,2-tris(diethylamino)ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 175722922 |
| Molecular Formula | C18H41N3O3 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.31 |
| IUPAC Name | 2-(hydroxymethyl)-2-[2,2,2-tris(diethylamino)ethyl]propane-1,3-diol |
| SMILES | CCN(CC)C(CC(CO)(CO)CO)(N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C18H41N3O3/c1-7-19(8-2)18(20(9-3)10-4,21(11-5)12-6)13-17(14-22,15-23)16-24/h22-24H,7-16H2,1-6H3 |
| InChIKey | DBZDQBRTTVJSBJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|