C30H65N3O3 — CID 175722962
2-(hydroxymethyl)-2-[2,2,2-tris(dibutylamino)ethyl]propane-1,3-diol (PubChem CID 175722962) has the molecular formula C30H65N3O3 and a molecular weight of 515.87 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-[2,2,2-tris(dibutylamino)ethyl]propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-[2,2,2-tris(dibutylamino)ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 175722962 |
| Molecular Formula | C30H65N3O3 |
| Molecular Weight | 515.87 g/mol |
| Exact Mass | 515.50 |
| IUPAC Name | 2-(hydroxymethyl)-2-[2,2,2-tris(dibutylamino)ethyl]propane-1,3-diol |
| SMILES | CCCCN(CCCC)C(CC(CO)(CO)CO)(N(CCCC)CCCC)N(CCCC)CCCC |
| InChI | InChI=1S/C30H65N3O3/c1-7-13-19-31(20-14-8-2)30(25-29(26-34,27-35)28-36,32(21-15-9-3)22-16-10-4)33(23-17-11-5)24-18-12-6/h34-36H,7-28H2,1-6H3 |
| InChIKey | GVMKEMFOFREVJL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.87 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|