C13H31N3 — CID 175352703
1-N',1-N',1-N",1-N"-tetraethyl-1-N,1-N-dimethylpropane-1,1,1-triamine (PubChem CID 175352703) has the molecular formula C13H31N3 and a molecular weight of 229.41 g/mol. Its IUPAC name is 1-N',1-N',1-N",1-N"-tetraethyl-1-N,1-N-dimethylpropane-1,1,1-triamine.
| Compound Name | 1-N',1-N',1-N",1-N"-tetraethyl-1-N,1-N-dimethylpropane-1,1,1-triamine |
|---|---|
| PubChem CID | 175352703 |
| Molecular Formula | C13H31N3 |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.25 |
| IUPAC Name | 1-N',1-N',1-N",1-N"-tetraethyl-1-N,1-N-dimethylpropane-1,1,1-triamine |
| SMILES | CCN(CC)C(CC)(N(C)C)N(CC)CC |
| InChI | InChI=1S/C13H31N3/c1-8-13(14(6)7,15(9-2)10-3)16(11-4)12-5/h8-12H2,1-7H3 |
| InChIKey | KAPCMRVPWXYEMH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|