C58H48N2O2S2 — CID 144761630
2,6-bis[4-(3,4-dihydrophenothiazin-10-yl)phenyl]anthracene-9,10-dione;(3Z)-penta-1,3-diene;prop-1-ene (PubChem CID 144761630) has the molecular formula C58H48N2O2S2 and a molecular weight of 869.17 g/mol. Its IUPAC name is 2,6-bis[4-(3,4-dihydrophenothiazin-10-yl)phenyl]anthracene-9,10-dione;(3Z)-penta-1,3-diene;prop-1-ene.
| Compound Name | 2,6-bis[4-(3,4-dihydrophenothiazin-10-yl)phenyl]anthracene-9,10-dione;(3Z)-penta-1,3-diene;prop-1-ene |
|---|---|
| PubChem CID | 144761630 |
| Molecular Formula | C58H48N2O2S2 |
| Molecular Weight | 869.17 g/mol |
| Exact Mass | 868.32 |
| IUPAC Name | 2,6-bis[4-(3,4-dihydrophenothiazin-10-yl)phenyl]anthracene-9,10-dione;(3Z)-penta-1,3-diene;prop-1-ene |
| SMILES | C=C/C=C\C.C=CC.O=C1c2ccc(-c3ccc(N4C5=C(CCC=C5)Sc5ccccc54)cc3)cc2C(=O)c2ccc(-c3ccc(N4C5=C(CCC=C5)Sc5ccccc54)cc3)cc21 |
| InChI | InChI=1S/C50H34N2O2S2.C5H8.C3H6/c53-49-38-28-22-34(32-19-25-36(26-20-32)52-43-11-3-7-15-47(43)56-48-16-8-4-12-44(48)52)30-40(38)50(54)37-27-21-33(29-39(37)49)31-17-23-35(24-18-31)51-41-9-1-5-13-45(41)55-46-14-6-2-10-42(46)51;1-3-5-4-2;1-3-2/h1-5,7,9-13,15,17-30H,6,8,14,16H2;3-5H,1H2,2H3;3H,1H2,2H3/b;5-4-; |
| InChIKey | WTLWSCONBWPBJJ-FXHNQCOHSA-N |
| XLogP | 16.35 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.17 |
| LogP ≤ 5 | 16.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|