C56H40N2S — CID 145290995
4-[4-(3,4-dihydrophenothiazin-10-yl)-9,9'-spirobi[fluorene]-2'-yl]-N-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-N-phenylaniline (PubChem CID 145290995) has the molecular formula C56H40N2S and a molecular weight of 773.02 g/mol. Its IUPAC name is 4-[4-(3,4-dihydrophenothiazin-10-yl)-9,9'-spirobi[fluorene]-2'-yl]-N-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-N-phenylaniline.
| Compound Name | 4-[4-(3,4-dihydrophenothiazin-10-yl)-9,9'-spirobi[fluorene]-2'-yl]-N-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-N-phenylaniline |
|---|---|
| PubChem CID | 145290995 |
| Molecular Formula | C56H40N2S |
| Molecular Weight | 773.02 g/mol |
| Exact Mass | 772.29 |
| IUPAC Name | 4-[4-(3,4-dihydrophenothiazin-10-yl)-9,9'-spirobi[fluorene]-2'-yl]-N-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-N-phenylaniline |
| SMILES | C#C/C=C\C(=C/C)N(c1ccccc1)c1ccc(-c2ccc3c(c2)C2(c4ccccc4-3)c3ccccc3-c3c(N4C5=C(CCC=C5)Sc5ccccc54)cccc32)cc1 |
| InChI | InChI=1S/C56H40N2S/c1-3-5-18-40(4-2)57(41-19-7-6-8-20-41)42-34-31-38(32-35-42)39-33-36-44-43-21-9-11-23-46(43)56(49(44)37-39)47-24-12-10-22-45(47)55-48(56)25-17-28-52(55)58-50-26-13-15-29-53(50)59-54-30-16-14-27-51(54)58/h1,4-15,17-29,31-37H,16,30H2,2H3/b18-5-,40-4+ |
| InChIKey | XUTOVUKJWKGLRW-QREBBAKCSA-N |
| XLogP | 14.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.02 |
| LogP ≤ 5 | 14.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|