C24H37ClN4O2S2 — CID 144762164
7-[(4-chlorophenyl)methyl]-3-methyl-1-propyl-8-propylsulfanylpurine-2,6-dione;ethane;propane-1-thiol (PubChem CID 144762164) has the molecular formula C24H37ClN4O2S2 and a molecular weight of 513.17 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-3-methyl-1-propyl-8-propylsulfanylpurine-2,6-dione;ethane;propane-1-thiol.
| Compound Name | 7-[(4-chlorophenyl)methyl]-3-methyl-1-propyl-8-propylsulfanylpurine-2,6-dione;ethane;propane-1-thiol |
|---|---|
| PubChem CID | 144762164 |
| Molecular Formula | C24H37ClN4O2S2 |
| Molecular Weight | 513.17 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-3-methyl-1-propyl-8-propylsulfanylpurine-2,6-dione;ethane;propane-1-thiol |
| SMILES | CC.CCCS.CCCSc1nc2c(c(=O)n(CCC)c(=O)n2C)n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23ClN4O2S.C3H8S.C2H6/c1-4-10-23-17(25)15-16(22(3)19(23)26)21-18(27-11-5-2)24(15)12-13-6-8-14(20)9-7-13;1-2-3-4;1-2/h6-9H,4-5,10-12H2,1-3H3;4H,2-3H2,1H3;1-2H3 |
| InChIKey | HDINLQKVJQYIJB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 61.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.17 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|