About ethane;(4-methyl-2,3-dihydro-1,3-thiazol-2-yl)methanol
ethane;(4-methyl-2,3-dihydro-1,3-thiazol-2-yl)methanol (PubChem CID 144762343) has the molecular formula C7H15NOS
and a molecular weight of 161.27 g/mol. Its IUPAC name is ethane;(4-methyl-2,3-dihydro-1,3-thiazol-2-yl)methanol.
Analyze ethane;(4-methyl-2,3-dihydro-1,3-thiazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4-methyl-2,3-dihydro-1,3-thiazol-2-yl)methanol?
The IUPAC name of ethane;(4-methyl-2,3-dihydro-1,3-thiazol-2-yl)methanol (CID 144762343) is ethane;(4-methyl-2,3-dihydro-1,3-thiazol-2-yl)methanol.
What is the SMILES notation for ethane;(4-methyl-2,3-dihydro-1,3-thiazol-2-yl)methanol?
The canonical SMILES for ethane;(4-methyl-2,3-dihydro-1,3-thiazol-2-yl)methanol is CC.CC1=CSC(CO)N1.
What is the InChIKey of ethane;(4-methyl-2,3-dihydro-1,3-thiazol-2-yl)methanol?
The InChIKey is STGNQBVZCSWGKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NOS.C2H6/c1-4-3-8-5(2-7)6-4;1-2/h3,5-7H,2H2,1H3;1-2H3.
What are the key properties of ethane;(4-methyl-2,3-dihydro-1,3-thiazol-2-yl)methanol?
ethane;(4-methyl-2,3-dihydro-1,3-thiazol-2-yl)methanol has a molecular weight of 161.27 g/mol, XLogP of 1.53, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4-methyl-2,3-dihydro-1,3-thiazol-2-yl)methanol is sourced from PubChem (CID 144762343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).