C6H11NOS — CID 141259283
2-(4-methyl-2H-1,3-thiazol-3-yl)ethanol (PubChem CID 141259283) has the molecular formula C6H11NOS and a molecular weight of 145.23 g/mol. Its IUPAC name is 2-(4-methyl-2H-1,3-thiazol-3-yl)ethanol.
| Compound Name | 2-(4-methyl-2H-1,3-thiazol-3-yl)ethanol |
|---|---|
| PubChem CID | 141259283 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 2-(4-methyl-2H-1,3-thiazol-3-yl)ethanol |
| SMILES | CC1=CSCN1CCO |
| InChI | InChI=1S/C6H11NOS/c1-6-4-9-5-7(6)2-3-8/h4,8H,2-3,5H2,1H3 |
| InChIKey | CJVPBNWJAGUGQL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |