About (5-bromo-3-ethyl-4-methyl-2H-1,3-thiazol-2-yl)methanol
(5-bromo-3-ethyl-4-methyl-2H-1,3-thiazol-2-yl)methanol (PubChem CID 174592468) has the molecular formula C7H12BrNOS
and a molecular weight of 238.15 g/mol. Its IUPAC name is (5-bromo-3-ethyl-4-methyl-2H-1,3-thiazol-2-yl)methanol.
Molecular Properties
| Compound Name | (5-bromo-3-ethyl-4-methyl-2H-1,3-thiazol-2-yl)methanol |
| PubChem CID | 174592468 |
| Molecular Formula | C7H12BrNOS |
| Molecular Weight | 238.15 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | (5-bromo-3-ethyl-4-methyl-2H-1,3-thiazol-2-yl)methanol |
| SMILES | CCN1C(C)=C(Br)SC1CO |
| InChI | InChI=1S/C7H12BrNOS/c1-3-9-5(2)7(8)11-6(9)4-10/h6,10H,3-4H2,1-2H3 |
| InChIKey | GRFXHUMSDPCLNT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.15 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-bromo-3-ethyl-4-methyl-2H-1,3-thiazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-3-ethyl-4-methyl-2H-1,3-thiazol-2-yl)methanol?
The IUPAC name of (5-bromo-3-ethyl-4-methyl-2H-1,3-thiazol-2-yl)methanol (CID 174592468) is (5-bromo-3-ethyl-4-methyl-2H-1,3-thiazol-2-yl)methanol.
What is the SMILES notation for (5-bromo-3-ethyl-4-methyl-2H-1,3-thiazol-2-yl)methanol?
The canonical SMILES for (5-bromo-3-ethyl-4-methyl-2H-1,3-thiazol-2-yl)methanol is CCN1C(C)=C(Br)SC1CO.
What is the InChIKey of (5-bromo-3-ethyl-4-methyl-2H-1,3-thiazol-2-yl)methanol?
The InChIKey is GRFXHUMSDPCLNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12BrNOS/c1-3-9-5(2)7(8)11-6(9)4-10/h6,10H,3-4H2,1-2H3.
What are the key properties of (5-bromo-3-ethyl-4-methyl-2H-1,3-thiazol-2-yl)methanol?
(5-bromo-3-ethyl-4-methyl-2H-1,3-thiazol-2-yl)methanol has a molecular weight of 238.15 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-3-ethyl-4-methyl-2H-1,3-thiazol-2-yl)methanol is sourced from PubChem (CID 174592468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).