C7H13NOS — CID 57261095
1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol (PubChem CID 57261095) has the molecular formula C7H13NOS and a molecular weight of 159.25 g/mol. Its IUPAC name is 1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol.
| Compound Name | 1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol |
|---|---|
| PubChem CID | 57261095 |
| Molecular Formula | C7H13NOS |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol |
| SMILES | CC1=CSCN1CC(C)O |
| InChI | InChI=1S/C7H13NOS/c1-6-4-10-5-8(6)3-7(2)9/h4,7,9H,3,5H2,1-2H3 |
| InChIKey | HKGSWHQQUMKWIT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |