C12H23F2NS — CID 144763414
N-tert-butylsulfanyl-2-(4,4-difluorocyclohexyl)ethanamine (PubChem CID 144763414) has the molecular formula C12H23F2NS and a molecular weight of 251.39 g/mol. Its IUPAC name is N-tert-butylsulfanyl-2-(4,4-difluorocyclohexyl)ethanamine.
| Compound Name | N-tert-butylsulfanyl-2-(4,4-difluorocyclohexyl)ethanamine |
|---|---|
| PubChem CID | 144763414 |
| Molecular Formula | C12H23F2NS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-tert-butylsulfanyl-2-(4,4-difluorocyclohexyl)ethanamine |
| SMILES | CC(C)(C)SNCCC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H23F2NS/c1-11(2,3)16-15-9-6-10-4-7-12(13,14)8-5-10/h10,15H,4-9H2,1-3H3 |
| InChIKey | RBNQHYRIORWHJD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|