C9H19F2N — CID 91075348
(4,4-difluorocyclohexyl)methanamine;ethane (PubChem CID 91075348) has the molecular formula C9H19F2N and a molecular weight of 179.25 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)methanamine;ethane.
| Compound Name | (4,4-difluorocyclohexyl)methanamine;ethane |
|---|---|
| PubChem CID | 91075348 |
| Molecular Formula | C9H19F2N |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.15 |
| IUPAC Name | (4,4-difluorocyclohexyl)methanamine;ethane |
| SMILES | CC.NCC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H13F2N.C2H6/c8-7(9)3-1-6(5-10)2-4-7;1-2/h6H,1-5,10H2;1-2H3 |
| InChIKey | RVDUGZWCIUZFSG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |