C35H37FN4O3S — CID 144763827
acetylene;2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide;(1-methylindol-3-yl)-piperidin-1-ylmethanone (PubChem CID 144763827) has the molecular formula C35H37FN4O3S and a molecular weight of 612.77 g/mol. Its IUPAC name is acetylene;2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide;(1-methylindol-3-yl)-piperidin-1-ylmethanone.
| Compound Name | acetylene;2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide;(1-methylindol-3-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 144763827 |
| Molecular Formula | C35H37FN4O3S |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | acetylene;2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide;(1-methylindol-3-yl)-piperidin-1-ylmethanone |
| SMILES | C#C.CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)SC)ccc12.Cn1cc(C(=O)N2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C18H17FN2O2S.C15H18N2O.C2H2/c1-20-18(22)16-14-9-8-13(21(2)24-3)10-15(14)23-17(16)11-4-6-12(19)7-5-11;1-16-11-13(12-7-3-4-8-14(12)16)15(18)17-9-5-2-6-10-17;1-2/h4-10H,1-3H3,(H,20,22);3-4,7-8,11H,2,5-6,9-10H2,1H3;1-2H |
| InChIKey | SBZTZCFRZADFDI-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|